C20H17N3O6 — CID 46189172
(6aS)-5-(5-methoxy-2-nitrobenzoyl)-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 46189172) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is (6aS)-5-(5-methoxy-2-nitrobenzoyl)-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aS)-5-(5-methoxy-2-nitrobenzoyl)-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 46189172 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (6aS)-5-(5-methoxy-2-nitrobenzoyl)-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | COc1ccc([N+](=O)[O-])c(C(=O)N2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C20H17N3O6/c1-29-12-8-9-16(23(27)28)14(11-12)19(25)22-15-6-3-2-5-13(15)18(24)21-10-4-7-17(21)20(22)26/h2-3,5-6,8-9,11,17H,4,7,10H2,1H3/t17-/m0/s1 |
| InChIKey | VJBSJGNYMZFINC-KRWDZBQOSA-N |
| XLogP | 2.39 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|