About [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate
[(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate (PubChem CID 46189366) has the molecular formula C14H25NO5
and a molecular weight of 287.36 g/mol. Its IUPAC name is [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate.
Molecular Properties
| Compound Name | [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate |
| PubChem CID | 46189366 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)OC[C@@H](NC(=O)CC(C)C)C(=O)OC |
| InChI | InChI=1S/C14H25NO5/c1-6-10(4)13(17)20-8-11(14(18)19-5)15-12(16)7-9(2)3/h9-11H,6-8H2,1-5H3,(H,15,16)/t10-,11+/m0/s1 |
| InChIKey | NRFRXBGEGSVYTR-WDEREUQCSA-N |
| XLogP | 1.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate?
The IUPAC name of [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate (CID 46189366) is [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate.
What is the SMILES notation for [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate?
The canonical SMILES for [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate is CC[C@H](C)C(=O)OC[C@@H](NC(=O)CC(C)C)C(=O)OC.
What is the InChIKey of [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate?
The InChIKey is NRFRXBGEGSVYTR-WDEREUQCSA-N. The full InChI is InChI=1S/C14H25NO5/c1-6-10(4)13(17)20-8-11(14(18)19-5)15-12(16)7-9(2)3/h9-11H,6-8H2,1-5H3,(H,15,16)/t10-,11+/m0/s1.
What are the key properties of [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate?
[(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate has a molecular weight of 287.36 g/mol, XLogP of 1.28, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3-methoxy-2-(3-methylbutanoylamino)-3-oxopropyl] (2S)-2-methylbutanoate is sourced from PubChem (CID 46189366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).