C17H32O — CID 46189708
(2E,4R,6E,8S)-4,8-diethyl-6-methyldodeca-2,6-dien-1-ol (PubChem CID 46189708) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is (2E,4R,6E,8S)-4,8-diethyl-6-methyldodeca-2,6-dien-1-ol.
| Compound Name | (2E,4R,6E,8S)-4,8-diethyl-6-methyldodeca-2,6-dien-1-ol |
|---|---|
| PubChem CID | 46189708 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | (2E,4R,6E,8S)-4,8-diethyl-6-methyldodeca-2,6-dien-1-ol |
| SMILES | CCCC[C@@H](/C=C(\C)C[C@H](/C=C/CO)CC)CC |
| InChI | InChI=1S/C17H32O/c1-5-8-10-16(6-2)13-15(4)14-17(7-3)11-9-12-18/h9,11,13,16-18H,5-8,10,12,14H2,1-4H3/b11-9+,15-13+/t16-,17-/m0/s1 |
| InChIKey | RBCUAQBDWIZQHY-ZUOPTHLSSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|