C14H11ClF3NO3S — CID 46191486
N-[3-chloro-4-[4-(trifluoromethoxy)phenyl]phenyl]methanesulfonamide (PubChem CID 46191486) has the molecular formula C14H11ClF3NO3S and a molecular weight of 365.76 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(trifluoromethoxy)phenyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-chloro-4-[4-(trifluoromethoxy)phenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 46191486 |
| Molecular Formula | C14H11ClF3NO3S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-[3-chloro-4-[4-(trifluoromethoxy)phenyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2ccc(OC(F)(F)F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClF3NO3S/c1-23(20,21)19-10-4-7-12(13(15)8-10)9-2-5-11(6-3-9)22-14(16,17)18/h2-8,19H,1H3 |
| InChIKey | BTFGZVBQNNAYCH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |