C20H30O7S — CID 46191815
[(2S,4R,6S)-4-hydroxy-6-[2-(oxan-2-yloxy)ethyl]oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 46191815) has the molecular formula C20H30O7S and a molecular weight of 414.52 g/mol. Its IUPAC name is [(2S,4R,6S)-4-hydroxy-6-[2-(oxan-2-yloxy)ethyl]oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6S)-4-hydroxy-6-[2-(oxan-2-yloxy)ethyl]oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46191815 |
| Molecular Formula | C20H30O7S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(2S,4R,6S)-4-hydroxy-6-[2-(oxan-2-yloxy)ethyl]oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@H](O)C[C@H](CCOC3CCCCO3)O2)cc1 |
| InChI | InChI=1S/C20H30O7S/c1-15-5-7-19(8-6-15)28(22,23)26-14-18-13-16(21)12-17(27-18)9-11-25-20-4-2-3-10-24-20/h5-8,16-18,20-21H,2-4,9-14H2,1H3/t16-,17+,18+,20?/m1/s1 |
| InChIKey | NXSQUGPQXUETRY-XFJOZDCWSA-N |
| XLogP | 2.54 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|