C21H24F2N2O2 — CID 4619215
1-[(2,4-difluorophenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 4619215) has the molecular formula C21H24F2N2O2 and a molecular weight of 374.43 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(2,4-difluorophenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4619215 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | CN(C)c1ccc(C(c2ccc(F)cc2F)N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C21H24F2N2O2/c1-24(2)17-6-3-14(4-7-17)20(18-8-5-16(22)13-19(18)23)25-11-9-15(10-12-25)21(26)27/h3-8,13,15,20H,9-12H2,1-2H3,(H,26,27) |
| InChIKey | FADFCBKKDZKFNU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|