C16H22O2 — CID 46192504
methyl 2-[(1S,2R,4R,7R,12R)-8-methylidene-2-tetracyclo[5.3.2.02,4.04,12]dodecanyl]acetate (PubChem CID 46192504) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is methyl 2-[(1S,2R,4R,7R,12R)-8-methylidene-2-tetracyclo[5.3.2.02,4.04,12]dodecanyl]acetate.
| Compound Name | methyl 2-[(1S,2R,4R,7R,12R)-8-methylidene-2-tetracyclo[5.3.2.02,4.04,12]dodecanyl]acetate |
|---|---|
| PubChem CID | 46192504 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | methyl 2-[(1S,2R,4R,7R,12R)-8-methylidene-2-tetracyclo[5.3.2.02,4.04,12]dodecanyl]acetate |
| SMILES | C=C1CC[C@H]2C[C@@H]3[C@H]1CC[C@@]31C[C@@]21CC(=O)OC |
| InChI | InChI=1S/C16H22O2/c1-10-3-4-11-7-13-12(10)5-6-15(13)9-16(11,15)8-14(17)18-2/h11-13H,1,3-9H2,2H3/t11-,12-,13+,15+,16-/m0/s1 |
| InChIKey | OVHHBPJWMKEJNA-CNBXADPUSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|