C10H20O3Si — CID 46193206
(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carbaldehyde (PubChem CID 46193206) has the molecular formula C10H20O3Si and a molecular weight of 216.35 g/mol. Its IUPAC name is (2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carbaldehyde.
| Compound Name | (2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 46193206 |
| Molecular Formula | C10H20O3Si |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@H]1C=O |
| InChI | InChI=1S/C10H20O3Si/c1-10(2,3)14(4,5)12-7-9-8(6-11)13-9/h6,8-9H,7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | ZZEAXSVHLYHJBB-IUCAKERBSA-N |
| XLogP | 1.97 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|