C33H50N6O3S — CID 46194552
N-tert-butyl-4-cyclohexyl-1-[(2R)-2-[3-(1H-imidazol-5-yl)propylcarbamothioylamino]-3-(4-methoxyphenyl)propanoyl]piperidine-4-carboxamide (PubChem CID 46194552) has the molecular formula C33H50N6O3S and a molecular weight of 610.87 g/mol. Its IUPAC name is N-tert-butyl-4-cyclohexyl-1-[(2R)-2-[3-(1H-imidazol-5-yl)propylcarbamothioylamino]-3-(4-methoxyphenyl)propanoyl]piperidine-4-carboxamide.
| Compound Name | N-tert-butyl-4-cyclohexyl-1-[(2R)-2-[3-(1H-imidazol-5-yl)propylcarbamothioylamino]-3-(4-methoxyphenyl)propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46194552 |
| Molecular Formula | C33H50N6O3S |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | N-tert-butyl-4-cyclohexyl-1-[(2R)-2-[3-(1H-imidazol-5-yl)propylcarbamothioylamino]-3-(4-methoxyphenyl)propanoyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(C[C@@H](NC(=S)NCCCc2cnc[nH]2)C(=O)N2CCC(C(=O)NC(C)(C)C)(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C33H50N6O3S/c1-32(2,3)38-30(41)33(25-9-6-5-7-10-25)16-19-39(20-17-33)29(40)28(21-24-12-14-27(42-4)15-13-24)37-31(43)35-18-8-11-26-22-34-23-36-26/h12-15,22-23,25,28H,5-11,16-21H2,1-4H3,(H,34,36)(H,38,41)(H2,35,37,43)/t28-/m1/s1 |
| InChIKey | FFJVNQKLZKMHQN-MUUNZHRXSA-N |
| XLogP | 4.53 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|