C28H40ClN5OS — CID 88962106
1-[(2R)-3-(4-chlorophenyl)-1-(4-cyclohexyl-2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]-3-[2-(1H-imidazol-5-yl)ethyl]thiourea (PubChem CID 88962106) has the molecular formula C28H40ClN5OS and a molecular weight of 530.18 g/mol. Its IUPAC name is 1-[(2R)-3-(4-chlorophenyl)-1-(4-cyclohexyl-2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]-3-[2-(1H-imidazol-5-yl)ethyl]thiourea.
| Compound Name | 1-[(2R)-3-(4-chlorophenyl)-1-(4-cyclohexyl-2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]-3-[2-(1H-imidazol-5-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 88962106 |
| Molecular Formula | C28H40ClN5OS |
| Molecular Weight | 530.18 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 1-[(2R)-3-(4-chlorophenyl)-1-(4-cyclohexyl-2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]-3-[2-(1H-imidazol-5-yl)ethyl]thiourea |
| SMILES | CCC1CC(C2CCCCC2)CCN1C(=O)[C@@H](Cc1ccc(Cl)cc1)NC(=S)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C28H40ClN5OS/c1-2-25-17-22(21-6-4-3-5-7-21)13-15-34(25)27(35)26(16-20-8-10-23(29)11-9-20)33-28(36)31-14-12-24-18-30-19-32-24/h8-11,18-19,21-22,25-26H,2-7,12-17H2,1H3,(H,30,32)(H2,31,33,36)/t22?,25?,26-/m1/s1 |
| InChIKey | BUPFWENMGFIAOU-TXDAUAKNSA-N |
| XLogP | 5.28 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.18 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|