C15H21N3O — CID 46195331
4-benzyl-8-methyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 46195331) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-benzyl-8-methyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 4-benzyl-8-methyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 46195331 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-benzyl-8-methyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | CN1CCC2(CC1)NCC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H21N3O/c1-17-9-7-15(8-10-17)16-11-14(19)18(15)12-13-5-3-2-4-6-13/h2-6,16H,7-12H2,1H3 |
| InChIKey | BSQPTZYKCAULBH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |