C14H19N3O — CID 46195333
4-benzyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 46195333) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 4-benzyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 4-benzyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 46195333 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 4-benzyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | O=C1CNC2(CCNCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H19N3O/c18-13-10-16-14(6-8-15-9-7-14)17(13)11-12-4-2-1-3-5-12/h1-5,15-16H,6-11H2 |
| InChIKey | MVQOVMPKXALKAP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |