C23H23F3N4O2 — CID 46196074
6-(4-methylphenyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-2-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 46196074) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is 6-(4-methylphenyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-2-propan-2-ylpyrimidine-4-carboxamide.
| Compound Name | 6-(4-methylphenyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-2-propan-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 46196074 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 6-(4-methylphenyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-2-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N[C@H](C)c3ccc(C(F)(F)F)[n+]([O-])c3)nc(C(C)C)n2)cc1 |
| InChI | InChI=1S/C23H23F3N4O2/c1-13(2)21-28-18(16-7-5-14(3)6-8-16)11-19(29-21)22(31)27-15(4)17-9-10-20(23(24,25)26)30(32)12-17/h5-13,15H,1-4H3,(H,27,31)/t15-/m1/s1 |
| InChIKey | RLUQFVXHURWYHD-OAHLLOKOSA-N |
| XLogP | 4.72 |
| TPSA | 81.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|