C26H19F3N4O3 — CID 46917302
4-(3-cyanophenyl)-2-(4-methylphenyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-1,3-oxazole-5-carboxamide (PubChem CID 46917302) has the molecular formula C26H19F3N4O3 and a molecular weight of 492.46 g/mol. Its IUPAC name is 4-(3-cyanophenyl)-2-(4-methylphenyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-1,3-oxazole-5-carboxamide.
| Compound Name | 4-(3-cyanophenyl)-2-(4-methylphenyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 46917302 |
| Molecular Formula | C26H19F3N4O3 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-(3-cyanophenyl)-2-(4-methylphenyl)-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ccc(-c2nc(-c3cccc(C#N)c3)c(C(=O)N[C@H](C)c3ccc(C(F)(F)F)[n+]([O-])c3)o2)cc1 |
| InChI | InChI=1S/C26H19F3N4O3/c1-15-6-8-18(9-7-15)25-32-22(19-5-3-4-17(12-19)13-30)23(36-25)24(34)31-16(2)20-10-11-21(26(27,28)29)33(35)14-20/h3-12,14,16H,1-2H3,(H,31,34)/t16-/m1/s1 |
| InChIKey | JCQIBFYYVIIFAP-MRXNPFEDSA-N |
| XLogP | 5.33 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|