C10H10F3N3O2S — CID 72696792
[methyl-[1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-oxo-λ6-sulfanylidene]cyanamide (PubChem CID 72696792) has the molecular formula C10H10F3N3O2S and a molecular weight of 293.27 g/mol. Its IUPAC name is [methyl-[1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-oxo-λ6-sulfanylidene]cyanamide.
| Compound Name | [methyl-[1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-oxo-λ6-sulfanylidene]cyanamide |
|---|---|
| PubChem CID | 72696792 |
| Molecular Formula | C10H10F3N3O2S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | [methyl-[1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]-oxo-λ6-sulfanylidene]cyanamide |
| SMILES | CC(c1ccc(C(F)(F)F)[n+]([O-])c1)S(C)(=O)=NC#N |
| InChI | InChI=1S/C10H10F3N3O2S/c1-7(19(2,18)15-6-14)8-3-4-9(10(11,12)13)16(17)5-8/h3-5,7H,1-2H3 |
| InChIKey | YCEFLRALSJQMIL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|