C21H23F3N4O3S — CID 167348188
1-[N-cyano-S-[4-(trifluoromethoxy)phenyl]sulfonimidoyl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 167348188) has the molecular formula C21H23F3N4O3S and a molecular weight of 468.50 g/mol. Its IUPAC name is 1-[N-cyano-S-[4-(trifluoromethoxy)phenyl]sulfonimidoyl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[N-cyano-S-[4-(trifluoromethoxy)phenyl]sulfonimidoyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 167348188 |
| Molecular Formula | C21H23F3N4O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1-[N-cyano-S-[4-(trifluoromethoxy)phenyl]sulfonimidoyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS(=O)(=NC#N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F3N4O3S/c1-13(2)17-6-5-7-18(14(3)4)19(17)27-20(29)28-32(30,26-12-25)16-10-8-15(9-11-16)31-21(22,23)24/h5-11,13-14H,1-4H3,(H2,26,27,28,29,30) |
| InChIKey | JGPZWJZMAVNEGG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|