C13H21NO5 — CID 46196948
(4S,5S)-N-methoxy-N,2,2-trimethyl-5-pent-4-enoyl-1,3-dioxolane-4-carboxamide (PubChem CID 46196948) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (4S,5S)-N-methoxy-N,2,2-trimethyl-5-pent-4-enoyl-1,3-dioxolane-4-carboxamide.
| Compound Name | (4S,5S)-N-methoxy-N,2,2-trimethyl-5-pent-4-enoyl-1,3-dioxolane-4-carboxamide |
|---|---|
| PubChem CID | 46196948 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (4S,5S)-N-methoxy-N,2,2-trimethyl-5-pent-4-enoyl-1,3-dioxolane-4-carboxamide |
| SMILES | C=CCCC(=O)[C@H]1OC(C)(C)O[C@@H]1C(=O)N(C)OC |
| InChI | InChI=1S/C13H21NO5/c1-6-7-8-9(15)10-11(12(16)14(4)17-5)19-13(2,3)18-10/h6,10-11H,1,7-8H2,2-5H3/t10-,11+/m1/s1 |
| InChIKey | RBSJLOUQNMWODR-MNOVXSKESA-N |
| XLogP | 1.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|