C19H19ClN2 — CID 46198736
2-[(4-chlorophenyl)methyl]-5-(4-propan-2-ylphenyl)-1H-imidazole (PubChem CID 46198736) has the molecular formula C19H19ClN2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-5-(4-propan-2-ylphenyl)-1H-imidazole.
| Compound Name | 2-[(4-chlorophenyl)methyl]-5-(4-propan-2-ylphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 46198736 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-5-(4-propan-2-ylphenyl)-1H-imidazole |
| SMILES | CC(C)c1ccc(-c2cnc(Cc3ccc(Cl)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C19H19ClN2/c1-13(2)15-5-7-16(8-6-15)18-12-21-19(22-18)11-14-3-9-17(20)10-4-14/h3-10,12-13H,11H2,1-2H3,(H,21,22) |
| InChIKey | QAJSVNHXNFAYRR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |