C18H12F6N2 — CID 18755583
5-[4-(trifluoromethyl)phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-1H-imidazole (PubChem CID 18755583) has the molecular formula C18H12F6N2 and a molecular weight of 370.30 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-1H-imidazole.
| Compound Name | 5-[4-(trifluoromethyl)phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-1H-imidazole |
|---|---|
| PubChem CID | 18755583 |
| Molecular Formula | C18H12F6N2 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 5-[4-(trifluoromethyl)phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-1H-imidazole |
| SMILES | FC(F)(F)c1ccc(Cc2ncc(-c3ccc(C(F)(F)F)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C18H12F6N2/c19-17(20,21)13-5-1-11(2-6-13)9-16-25-10-15(26-16)12-3-7-14(8-4-12)18(22,23)24/h1-8,10H,9H2,(H,25,26) |
| InChIKey | GLPDGFJFDJONGS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |