C14H16F3N3O — CID 63954276
2-methoxy-N-[[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]methyl]ethanamine (PubChem CID 63954276) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-methoxy-N-[[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63954276 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-methoxy-N-[[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]methyl]ethanamine |
| SMILES | COCCNCc1ncc(-c2ccc(C(F)(F)F)cc2)[nH]1 |
| InChI | InChI=1S/C14H16F3N3O/c1-21-7-6-18-9-13-19-8-12(20-13)10-2-4-11(5-3-10)14(15,16)17/h2-5,8,18H,6-7,9H2,1H3,(H,19,20) |
| InChIKey | UVVIQVPVBJGKCH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|