C17H18F3N7 — CID 46199405
3-(6-methyl-1H-benzimidazol-2-yl)-5-[4-(trifluoromethyl)piperazin-1-yl]pyrazin-2-amine (PubChem CID 46199405) has the molecular formula C17H18F3N7 and a molecular weight of 377.37 g/mol. Its IUPAC name is 3-(6-methyl-1H-benzimidazol-2-yl)-5-[4-(trifluoromethyl)piperazin-1-yl]pyrazin-2-amine.
| Compound Name | 3-(6-methyl-1H-benzimidazol-2-yl)-5-[4-(trifluoromethyl)piperazin-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 46199405 |
| Molecular Formula | C17H18F3N7 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-(6-methyl-1H-benzimidazol-2-yl)-5-[4-(trifluoromethyl)piperazin-1-yl]pyrazin-2-amine |
| SMILES | Cc1ccc2nc(-c3nc(N4CCN(C(F)(F)F)CC4)cnc3N)[nH]c2c1 |
| InChI | InChI=1S/C17H18F3N7/c1-10-2-3-11-12(8-10)24-16(23-11)14-15(21)22-9-13(25-14)26-4-6-27(7-5-26)17(18,19)20/h2-3,8-9H,4-7H2,1H3,(H2,21,22)(H,23,24) |
| InChIKey | VPFLFWPJIRNGRS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|