C12H10BN5 — CID 88572792
CID 88572792 (PubChem CID 88572792) has the molecular formula C12H10BN5 and a molecular weight of 235.06 g/mol.
| Compound Name | CID 88572792 |
|---|---|
| PubChem CID | 88572792 |
| Molecular Formula | C12H10BN5 |
| Molecular Weight | 235.06 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(N)c(-c2nc3ccc(C)cc3[nH]2)n1 |
| InChI | InChI=1S/C12H10BN5/c1-6-2-3-7-8(4-6)17-12(16-7)10-11(14)15-5-9(13)18-10/h2-5H,1H3,(H2,14,15)(H,16,17) |
| InChIKey | ANXDCSCNFSHQDG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.06 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|