C26H29FN2O2 — CID 46199672
2-[2-[4-[4-[(4-fluoro-N-propan-2-ylanilino)methyl]phenyl]phenyl]ethylamino]acetic acid (PubChem CID 46199672) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-[2-[4-[4-[(4-fluoro-N-propan-2-ylanilino)methyl]phenyl]phenyl]ethylamino]acetic acid.
| Compound Name | 2-[2-[4-[4-[(4-fluoro-N-propan-2-ylanilino)methyl]phenyl]phenyl]ethylamino]acetic acid |
|---|---|
| PubChem CID | 46199672 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-[2-[4-[4-[(4-fluoro-N-propan-2-ylanilino)methyl]phenyl]phenyl]ethylamino]acetic acid |
| SMILES | CC(C)N(Cc1ccc(-c2ccc(CCNCC(=O)O)cc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H29FN2O2/c1-19(2)29(25-13-11-24(27)12-14-25)18-21-5-9-23(10-6-21)22-7-3-20(4-8-22)15-16-28-17-26(30)31/h3-14,19,28H,15-18H2,1-2H3,(H,30,31) |
| InChIKey | LIDQIPYEWBFFPI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|