C22H23FN2O2S — CID 112985063
N-[4-[benzyl(propan-2-yl)amino]phenyl]-4-fluorobenzenesulfonamide (PubChem CID 112985063) has the molecular formula C22H23FN2O2S and a molecular weight of 398.50 g/mol. Its IUPAC name is N-[4-[benzyl(propan-2-yl)amino]phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-[benzyl(propan-2-yl)amino]phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 112985063 |
| Molecular Formula | C22H23FN2O2S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[4-[benzyl(propan-2-yl)amino]phenyl]-4-fluorobenzenesulfonamide |
| SMILES | CC(C)N(Cc1ccccc1)c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H23FN2O2S/c1-17(2)25(16-18-6-4-3-5-7-18)21-12-10-20(11-13-21)24-28(26,27)22-14-8-19(23)9-15-22/h3-15,17,24H,16H2,1-2H3 |
| InChIKey | BELQJTFIIBLOMA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |