C25H21F2N5O5 — CID 46200283
(5S)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[6-fluoro-5-(1,2,3,6-tetrahydropyridin-4-yl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione (PubChem CID 46200283) has the molecular formula C25H21F2N5O5 and a molecular weight of 509.47 g/mol. Its IUPAC name is (5S)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[6-fluoro-5-(1,2,3,6-tetrahydropyridin-4-yl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[6-fluoro-5-(1,2,3,6-tetrahydropyridin-4-yl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46200283 |
| Molecular Formula | C25H21F2N5O5 |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (5S)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[6-fluoro-5-(1,2,3,6-tetrahydropyridin-4-yl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N(C[C@@]1(c3cc4nc(C5=CCNCC5)c(F)cc4o3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C25H21F2N5O5/c1-36-16-3-2-13-10-32(22(33)19(13)20(16)27)11-25(23(34)30-24(35)31-25)18-9-15-17(37-18)8-14(26)21(29-15)12-4-6-28-7-5-12/h2-4,8-9,28H,5-7,10-11H2,1H3,(H2,30,31,34,35)/t25-/m0/s1 |
| InChIKey | XANSDONOYACNNX-VWLOTQADSA-N |
| XLogP | 2.18 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|