C20H13ClF2N4O5 — CID 46200284
(5S)-5-(5-chloro-6-fluorofuro[3,2-b]pyridin-2-yl)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 46200284) has the molecular formula C20H13ClF2N4O5 and a molecular weight of 462.80 g/mol. Its IUPAC name is (5S)-5-(5-chloro-6-fluorofuro[3,2-b]pyridin-2-yl)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(5-chloro-6-fluorofuro[3,2-b]pyridin-2-yl)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46200284 |
| Molecular Formula | C20H13ClF2N4O5 |
| Molecular Weight | 462.80 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | (5S)-5-(5-chloro-6-fluorofuro[3,2-b]pyridin-2-yl)-5-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N(C[C@@]1(c3cc4nc(Cl)c(F)cc4o3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C20H13ClF2N4O5/c1-31-11-3-2-8-6-27(17(28)14(8)15(11)23)7-20(18(29)25-19(30)26-20)13-5-10-12(32-13)4-9(22)16(21)24-10/h2-5H,6-7H2,1H3,(H2,25,26,29,30)/t20-/m0/s1 |
| InChIKey | LDLINXNHIZVOSH-FQEVSTJZSA-N |
| XLogP | 2.46 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|