C17H11FN2O5 — CID 46201431
benzyl 2-(2-fluoro-4-nitrophenyl)-1,3-oxazole-4-carboxylate (PubChem CID 46201431) has the molecular formula C17H11FN2O5 and a molecular weight of 342.28 g/mol. Its IUPAC name is benzyl 2-(2-fluoro-4-nitrophenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | benzyl 2-(2-fluoro-4-nitrophenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 46201431 |
| Molecular Formula | C17H11FN2O5 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | benzyl 2-(2-fluoro-4-nitrophenyl)-1,3-oxazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1coc(-c2ccc([N+](=O)[O-])cc2F)n1 |
| InChI | InChI=1S/C17H11FN2O5/c18-14-8-12(20(22)23)6-7-13(14)16-19-15(10-24-16)17(21)25-9-11-4-2-1-3-5-11/h1-8,10H,9H2 |
| InChIKey | OTFARDMDOXLJLQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|