C29H35N3O2 — CID 46202613
[(1R,8S,9R)-9-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl] cyclopropanecarboxylate (PubChem CID 46202613) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is [(1R,8S,9R)-9-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl] cyclopropanecarboxylate.
| Compound Name | [(1R,8S,9R)-9-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 46202613 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | [(1R,8S,9R)-9-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl] cyclopropanecarboxylate |
| SMILES | CN(CCCc1nc2ccccc2[nH]1)CC[C@]1(OC(=O)C2CC2)C[C@H]2CC[C@H]1c1ccccc12 |
| InChI | InChI=1S/C29H35N3O2/c1-32(17-6-11-27-30-25-9-4-5-10-26(25)31-27)18-16-29(34-28(33)20-12-13-20)19-21-14-15-24(29)23-8-3-2-7-22(21)23/h2-5,7-10,20-21,24H,6,11-19H2,1H3,(H,30,31)/t21-,24+,29+/m1/s1 |
| InChIKey | GERVYTOORWZGGL-JICQUXPRSA-N |
| XLogP | 5.57 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |