C33H41N3O2 — CID 91443785
[(1R,12R,14S)-14-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-14-tetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3,5,7-tetraenyl] 2-methylpropanoate (PubChem CID 91443785) has the molecular formula C33H41N3O2 and a molecular weight of 511.71 g/mol. Its IUPAC name is [(1R,12R,14S)-14-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-14-tetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3,5,7-tetraenyl] 2-methylpropanoate.
| Compound Name | [(1R,12R,14S)-14-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-14-tetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3,5,7-tetraenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 91443785 |
| Molecular Formula | C33H41N3O2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | [(1R,12R,14S)-14-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-14-tetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3,5,7-tetraenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@]1(CCN(C)CCCc2nc3ccccc3[nH]2)C[C@H]2CC[C@@H]1C1=C2CCc2ccccc21 |
| InChI | InChI=1S/C33H41N3O2/c1-22(2)32(37)38-33(18-20-36(3)19-8-13-30-34-28-11-6-7-12-29(28)35-30)21-24-15-17-27(33)31-25-10-5-4-9-23(25)14-16-26(24)31/h4-7,9-12,22,24,27H,8,13-21H2,1-3H3,(H,34,35)/t24-,27-,33-/m1/s1 |
| InChIKey | HHEQYLCZNVNYEY-YVNJXZLRSA-N |
| XLogP | 6.59 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |