C16H14N6OS — CID 46204597
4-[5-(1H-indazol-4-yl)-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]morpholine (PubChem CID 46204597) has the molecular formula C16H14N6OS and a molecular weight of 338.40 g/mol. Its IUPAC name is 4-[5-(1H-indazol-4-yl)-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]morpholine.
| Compound Name | 4-[5-(1H-indazol-4-yl)-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]morpholine |
|---|---|
| PubChem CID | 46204597 |
| Molecular Formula | C16H14N6OS |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[5-(1H-indazol-4-yl)-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]morpholine |
| SMILES | c1cc(-c2nc(N3CCOCC3)c3scnc3n2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C16H14N6OS/c1-2-10(11-8-18-21-12(11)3-1)14-19-15-13(24-9-17-15)16(20-14)22-4-6-23-7-5-22/h1-3,8-9H,4-7H2,(H,18,21) |
| InChIKey | YRRCKBNBNPXSLU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |