C22H31Cl2NO2 — CID 46204806
2-amino-2-[2-[2-chloro-4-(4-pentylphenyl)phenyl]ethyl]propane-1,3-diol;hydrochloride (PubChem CID 46204806) has the molecular formula C22H31Cl2NO2 and a molecular weight of 412.40 g/mol. Its IUPAC name is 2-amino-2-[2-[2-chloro-4-(4-pentylphenyl)phenyl]ethyl]propane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-2-[2-[2-chloro-4-(4-pentylphenyl)phenyl]ethyl]propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 46204806 |
| Molecular Formula | C22H31Cl2NO2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-amino-2-[2-[2-chloro-4-(4-pentylphenyl)phenyl]ethyl]propane-1,3-diol;hydrochloride |
| SMILES | CCCCCc1ccc(-c2ccc(CCC(N)(CO)CO)c(Cl)c2)cc1.Cl |
| InChI | InChI=1S/C22H30ClNO2.ClH/c1-2-3-4-5-17-6-8-18(9-7-17)20-11-10-19(21(23)14-20)12-13-22(24,15-25)16-26;/h6-11,14,25-26H,2-5,12-13,15-16,24H2,1H3;1H |
| InChIKey | RBOWUMXMBTYQRS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|