C30H31F3N4O3 — CID 46205230
(4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(oxan-4-yl)-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 46205230) has the molecular formula C30H31F3N4O3 and a molecular weight of 552.60 g/mol. Its IUPAC name is (4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(oxan-4-yl)-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(oxan-4-yl)-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 46205230 |
| Molecular Formula | C30H31F3N4O3 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | (4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(oxan-4-yl)-4-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOC(C2CCOCC2)[C@@H]3c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C30H31F3N4O3/c1-18-16-36(17-34-18)25-6-5-19(13-26(25)38-2)12-21-4-3-9-37-28(22-14-23(31)27(33)24(32)15-22)29(40-35-30(21)37)20-7-10-39-11-8-20/h5-6,12-17,20,28-29H,3-4,7-11H2,1-2H3/b21-12+/t28-,29?/m0/s1 |
| InChIKey | YDFCTEPEGWAUMQ-BRJRXRJYSA-N |
| XLogP | 5.97 |
| TPSA | 61.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|