C27H46N4O4S2 — CID 46205308
1-(1-methylpiperidin-4-yl)-4-[4-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-yl]butylsulfonyl]piperazine (PubChem CID 46205308) has the molecular formula C27H46N4O4S2 and a molecular weight of 554.82 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-4-[4-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-yl]butylsulfonyl]piperazine.
| Compound Name | 1-(1-methylpiperidin-4-yl)-4-[4-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-yl]butylsulfonyl]piperazine |
|---|---|
| PubChem CID | 46205308 |
| Molecular Formula | C27H46N4O4S2 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-4-[4-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-yl]butylsulfonyl]piperazine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC2CCCCS(=O)(=O)N2CCN(C3CCN(C)CC3)CC2)c(C)c1 |
| InChI | InChI=1S/C27H46N4O4S2/c1-22-20-23(2)27(24(3)21-22)37(34,35)31-12-7-9-26(31)8-5-6-19-36(32,33)30-17-15-29(16-18-30)25-10-13-28(4)14-11-25/h20-21,25-26H,5-19H2,1-4H3 |
| InChIKey | XXCDNGRPBXIEGL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|