C28H44Cl2N4O4S2 — CID 66754332
1-(1-methylpiperidin-4-yl)-4-[4-(1-naphthalen-1-ylsulfonylpyrrolidin-2-yl)butylsulfonyl]piperazine;dihydrochloride (PubChem CID 66754332) has the molecular formula C28H44Cl2N4O4S2 and a molecular weight of 635.72 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-4-[4-(1-naphthalen-1-ylsulfonylpyrrolidin-2-yl)butylsulfonyl]piperazine;dihydrochloride.
| Compound Name | 1-(1-methylpiperidin-4-yl)-4-[4-(1-naphthalen-1-ylsulfonylpyrrolidin-2-yl)butylsulfonyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 66754332 |
| Molecular Formula | C28H44Cl2N4O4S2 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-4-[4-(1-naphthalen-1-ylsulfonylpyrrolidin-2-yl)butylsulfonyl]piperazine;dihydrochloride |
| SMILES | CN1CCC(N2CCN(S(=O)(=O)CCCCC3CCCN3S(=O)(=O)c3cccc4ccccc34)CC2)CC1.Cl.Cl |
| InChI | InChI=1S/C28H42N4O4S2.2ClH/c1-29-17-14-25(15-18-29)30-19-21-31(22-20-30)37(33,34)23-5-4-10-26-11-7-16-32(26)38(35,36)28-13-6-9-24-8-2-3-12-27(24)28;;/h2-3,6,8-9,12-13,25-26H,4-5,7,10-11,14-23H2,1H3;2*1H |
| InChIKey | PNKPPSAODXGZNF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|