C26H32N4O4S2 — CID 68603377
1-[3-(1-naphthalen-2-ylsulfonylpyrrolidin-2-yl)propylsulfonyl]-4-pyridin-4-ylpiperazine (PubChem CID 68603377) has the molecular formula C26H32N4O4S2 and a molecular weight of 528.70 g/mol. Its IUPAC name is 1-[3-(1-naphthalen-2-ylsulfonylpyrrolidin-2-yl)propylsulfonyl]-4-pyridin-4-ylpiperazine.
| Compound Name | 1-[3-(1-naphthalen-2-ylsulfonylpyrrolidin-2-yl)propylsulfonyl]-4-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 68603377 |
| Molecular Formula | C26H32N4O4S2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 1-[3-(1-naphthalen-2-ylsulfonylpyrrolidin-2-yl)propylsulfonyl]-4-pyridin-4-ylpiperazine |
| SMILES | O=S(=O)(CCCC1CCCN1S(=O)(=O)c1ccc2ccccc2c1)N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C26H32N4O4S2/c31-35(32,29-18-16-28(17-19-29)24-11-13-27-14-12-24)20-4-8-25-7-3-15-30(25)36(33,34)26-10-9-22-5-1-2-6-23(22)21-26/h1-2,5-6,9-14,21,25H,3-4,7-8,15-20H2 |
| InChIKey | YAKDYFRLJUCOAE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |