C33H33ClN4O3 — CID 46208168
(2S)-2-[[(E)-3-(6-chloro-3-pyridinyl)prop-2-enoyl]-[(4-pyridin-3-ylphenyl)methyl]amino]-N-(2-methoxyethyl)-N-methyl-3-phenylpropanamide (PubChem CID 46208168) has the molecular formula C33H33ClN4O3 and a molecular weight of 569.11 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(6-chloro-3-pyridinyl)prop-2-enoyl]-[(4-pyridin-3-ylphenyl)methyl]amino]-N-(2-methoxyethyl)-N-methyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(E)-3-(6-chloro-3-pyridinyl)prop-2-enoyl]-[(4-pyridin-3-ylphenyl)methyl]amino]-N-(2-methoxyethyl)-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 46208168 |
| Molecular Formula | C33H33ClN4O3 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | (2S)-2-[[(E)-3-(6-chloro-3-pyridinyl)prop-2-enoyl]-[(4-pyridin-3-ylphenyl)methyl]amino]-N-(2-methoxyethyl)-N-methyl-3-phenylpropanamide |
| SMILES | COCCN(C)C(=O)[C@H](Cc1ccccc1)N(Cc1ccc(-c2cccnc2)cc1)C(=O)/C=C/c1ccc(Cl)nc1 |
| InChI | InChI=1S/C33H33ClN4O3/c1-37(19-20-41-2)33(40)30(21-25-7-4-3-5-8-25)38(32(39)17-13-26-12-16-31(34)36-22-26)24-27-10-14-28(15-11-27)29-9-6-18-35-23-29/h3-18,22-23,30H,19-21,24H2,1-2H3/b17-13+/t30-/m0/s1 |
| InChIKey | VMDMYJGSKRHZDG-DBPHFDSVSA-N |
| XLogP | 5.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|