C26H28ClN5O2S — CID 46208865
N-(2-chloro-6-methylphenyl)-2-[[2-[(E)-4-(ethylamino)but-2-enoyl]-3,4-dihydro-1H-isoquinolin-6-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 46208865) has the molecular formula C26H28ClN5O2S and a molecular weight of 510.06 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[2-[(E)-4-(ethylamino)but-2-enoyl]-3,4-dihydro-1H-isoquinolin-6-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[2-[(E)-4-(ethylamino)but-2-enoyl]-3,4-dihydro-1H-isoquinolin-6-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46208865 |
| Molecular Formula | C26H28ClN5O2S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[2-[(E)-4-(ethylamino)but-2-enoyl]-3,4-dihydro-1H-isoquinolin-6-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | CCNC/C=C/C(=O)N1CCc2cc(Nc3ncc(C(=O)Nc4c(C)cccc4Cl)s3)ccc2C1 |
| InChI | InChI=1S/C26H28ClN5O2S/c1-3-28-12-5-8-23(33)32-13-11-18-14-20(10-9-19(18)16-32)30-26-29-15-22(35-26)25(34)31-24-17(2)6-4-7-21(24)27/h4-10,14-15,28H,3,11-13,16H2,1-2H3,(H,29,30)(H,31,34)/b8-5+ |
| InChIKey | DCBONXCEWPDNGY-VMPITWQZSA-N |
| XLogP | 5.15 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|