C15H18N4O — CID 4620890
2-ethyl-3-ethylimino-1,4-dihydropyrazino[2,1-b]quinazolin-6-one (PubChem CID 4620890) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-ethyl-3-ethylimino-1,4-dihydropyrazino[2,1-b]quinazolin-6-one.
| Compound Name | 2-ethyl-3-ethylimino-1,4-dihydropyrazino[2,1-b]quinazolin-6-one |
|---|---|
| PubChem CID | 4620890 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-ethyl-3-ethylimino-1,4-dihydropyrazino[2,1-b]quinazolin-6-one |
| SMILES | CC/N=C1\Cn2c(nc3ccccc3c2=O)CN1CC |
| InChI | InChI=1S/C15H18N4O/c1-3-16-13-10-19-14(9-18(13)4-2)17-12-8-6-5-7-11(12)15(19)20/h5-8H,3-4,9-10H2,1-2H3/b16-13+ |
| InChIKey | NBVGOYZAMXYUCS-DTQAZKPQSA-N |
| XLogP | 1.65 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|