C11H10N4O — CID 2160998
3-amino-1,4-dihydropyrazino[2,1-b]quinazolin-6-one (PubChem CID 2160998) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 3-amino-1,4-dihydropyrazino[2,1-b]quinazolin-6-one.
| Compound Name | 3-amino-1,4-dihydropyrazino[2,1-b]quinazolin-6-one |
|---|---|
| PubChem CID | 2160998 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-amino-1,4-dihydropyrazino[2,1-b]quinazolin-6-one |
| SMILES | NC1=NCc2nc3ccccc3c(=O)n2C1 |
| InChI | InChI=1S/C11H10N4O/c12-9-6-15-10(5-13-9)14-8-4-2-1-3-7(8)11(15)16/h1-4H,5-6H2,(H2,12,13) |
| InChIKey | CGVRFFUJYXEKKK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |