C10H8N4OS — CID 18592735
3-amino-2H-[1,3,4]thiadiazino[2,3-b]quinazolin-6-one (PubChem CID 18592735) has the molecular formula C10H8N4OS and a molecular weight of 232.27 g/mol. Its IUPAC name is 3-amino-2H-[1,3,4]thiadiazino[2,3-b]quinazolin-6-one.
| Compound Name | 3-amino-2H-[1,3,4]thiadiazino[2,3-b]quinazolin-6-one |
|---|---|
| PubChem CID | 18592735 |
| Molecular Formula | C10H8N4OS |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 3-amino-2H-[1,3,4]thiadiazino[2,3-b]quinazolin-6-one |
| SMILES | NC1=Nn2c(nc3ccccc3c2=O)SC1 |
| InChI | InChI=1S/C10H8N4OS/c11-8-5-16-10-12-7-4-2-1-3-6(7)9(15)14(10)13-8/h1-4H,5H2,(H2,11,13) |
| InChIKey | TYQFVWNZUQBYRB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |