About 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one
3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one (PubChem CID 1479805) has the molecular formula C11H8N2OS
and a molecular weight of 216.26 g/mol. Its IUPAC name is 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one.
Molecular Properties
| Compound Name | 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one |
| PubChem CID | 1479805 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one |
| SMILES | C=C1CSc2nc3ccccc3c(=O)n21 |
| InChI | InChI=1S/C11H8N2OS/c1-7-6-15-11-12-9-5-3-2-4-8(9)10(14)13(7)11/h2-5H,1,6H2 |
| InChIKey | MUZVXQJHKZMQAI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one?
The IUPAC name of 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one (CID 1479805) is 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one.
What is the SMILES notation for 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one?
The canonical SMILES for 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one is C=C1CSc2nc3ccccc3c(=O)n21.
What is the InChIKey of 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one?
The InChIKey is MUZVXQJHKZMQAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2OS/c1-7-6-15-11-12-9-5-3-2-4-8(9)10(14)13(7)11/h2-5H,1,6H2.
What are the key properties of 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one?
3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one has a molecular weight of 216.26 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidene-[1,3]thiazolo[2,3-b]quinazolin-5-one is sourced from PubChem (CID 1479805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).