C11H8N2O2S — CID 102502109
8-methyl-[1,3]thiazolo[2,3-b]quinazoline-3,5-dione (PubChem CID 102502109) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is 8-methyl-[1,3]thiazolo[2,3-b]quinazoline-3,5-dione.
| Compound Name | 8-methyl-[1,3]thiazolo[2,3-b]quinazoline-3,5-dione |
|---|---|
| PubChem CID | 102502109 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 8-methyl-[1,3]thiazolo[2,3-b]quinazoline-3,5-dione |
| SMILES | Cc1ccc2c(=O)n3c(nc2c1)SCC3=O |
| InChI | InChI=1S/C11H8N2O2S/c1-6-2-3-7-8(4-6)12-11-13(10(7)15)9(14)5-16-11/h2-4H,5H2,1H3 |
| InChIKey | YRJWKLONSMBIDX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |