C15H11N3OS2 — CID 2816629
12-methyl-5-phenyl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one (PubChem CID 2816629) has the molecular formula C15H11N3OS2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 12-methyl-5-phenyl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one.
| Compound Name | 12-methyl-5-phenyl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one |
|---|---|
| PubChem CID | 2816629 |
| Molecular Formula | C15H11N3OS2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 12-methyl-5-phenyl-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraen-2-one |
| SMILES | CC1=Nn2c(nc3sc(-c4ccccc4)cc3c2=O)SC1 |
| InChI | InChI=1S/C15H11N3OS2/c1-9-8-20-15-16-13-11(14(19)18(15)17-9)7-12(21-13)10-5-3-2-4-6-10/h2-7H,8H2,1H3 |
| InChIKey | KTSMNVQNZBTWKF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |