C19H11N3O2S — CID 15048211
14-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,12(16),13-hexaene-8,11-dione (PubChem CID 15048211) has the molecular formula C19H11N3O2S and a molecular weight of 345.38 g/mol. Its IUPAC name is 14-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,12(16),13-hexaene-8,11-dione.
| Compound Name | 14-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,12(16),13-hexaene-8,11-dione |
|---|---|
| PubChem CID | 15048211 |
| Molecular Formula | C19H11N3O2S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 14-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,12(16),13-hexaene-8,11-dione |
| SMILES | O=c1[nH]n2c(=O)c3cc(-c4ccccc4)sc3nc2c2ccccc12 |
| InChI | InChI=1S/C19H11N3O2S/c23-17-13-9-5-4-8-12(13)16-20-18-14(19(24)22(16)21-17)10-15(25-18)11-6-2-1-3-7-11/h1-10H,(H,21,23) |
| InChIKey | KFOJLFNUZVVYPJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|