C26H17N3OS — CID 2384052
8-(4-methylphenyl)-14-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one (PubChem CID 2384052) has the molecular formula C26H17N3OS and a molecular weight of 419.51 g/mol. Its IUPAC name is 8-(4-methylphenyl)-14-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one.
| Compound Name | 8-(4-methylphenyl)-14-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
|---|---|
| PubChem CID | 2384052 |
| Molecular Formula | C26H17N3OS |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 8-(4-methylphenyl)-14-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
| SMILES | Cc1ccc(-c2nn3c(=O)c4cc(-c5ccccc5)sc4nc3c3ccccc23)cc1 |
| InChI | InChI=1S/C26H17N3OS/c1-16-11-13-18(14-12-16)23-19-9-5-6-10-20(19)24-27-25-21(26(30)29(24)28-23)15-22(31-25)17-7-3-2-4-8-17/h2-15H,1H3 |
| InChIKey | VCOGQSPEJWUUOZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|