C13H10N2O3S2 — CID 95528669
2-methylsulfonyl-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 95528669) has the molecular formula C13H10N2O3S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-methylsulfonyl-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-methylsulfonyl-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 95528669 |
| Molecular Formula | C13H10N2O3S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-methylsulfonyl-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CS(=O)(=O)c1nc2sc(-c3ccccc3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H10N2O3S2/c1-20(17,18)13-14-11(16)9-7-10(19-12(9)15-13)8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15,16) |
| InChIKey | YARRONYGTXPCLZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |