C14H11N3OS3 — CID 39158891
2-[(4-oxo-6-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]ethanethioamide (PubChem CID 39158891) has the molecular formula C14H11N3OS3 and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-[(4-oxo-6-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]ethanethioamide.
| Compound Name | 2-[(4-oxo-6-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]ethanethioamide |
|---|---|
| PubChem CID | 39158891 |
| Molecular Formula | C14H11N3OS3 |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-[(4-oxo-6-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]ethanethioamide |
| SMILES | NC(=S)CSc1nc2sc(-c3ccccc3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H11N3OS3/c15-11(19)7-20-14-16-12(18)9-6-10(21-13(9)17-14)8-4-2-1-3-5-8/h1-6H,7H2,(H2,15,19)(H,16,17,18) |
| InChIKey | JHTVAFGAKVXBLS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|