C17H11N3OS — CID 2099944
6-phenyl-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 2099944) has the molecular formula C17H11N3OS and a molecular weight of 305.36 g/mol. Its IUPAC name is 6-phenyl-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-phenyl-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2099944 |
| Molecular Formula | C17H11N3OS |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 6-phenyl-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccccn2)nc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C17H11N3OS/c21-16-12-10-14(11-6-2-1-3-7-11)22-17(12)20-15(19-16)13-8-4-5-9-18-13/h1-10H,(H,19,20,21) |
| InChIKey | IKCQYPIFZFLJAS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |