C22H21N5O2S — CID 46209047
1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidin-4-ol (PubChem CID 46209047) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidin-4-ol.
| Compound Name | 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 46209047 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidin-4-ol |
| SMILES | OC1CCN(c2nccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C22H21N5O2S/c28-16-9-13-27(14-10-16)20-21(24-12-11-23-20)29-17-7-5-15(6-8-17)25-22-26-18-3-1-2-4-19(18)30-22/h1-8,11-12,16,28H,9-10,13-14H2,(H,25,26) |
| InChIKey | UHSVYLFWFQNXRY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |