About [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate
[1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate (PubChem CID 89075218) has the molecular formula C21H17N5O4S
and a molecular weight of 435.47 g/mol. Its IUPAC name is [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate |
| PubChem CID | 89075218 |
| Molecular Formula | C21H17N5O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)OC1CN(c2nccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)C1 |
| InChI | InChI=1S/C21H17N5O4S/c27-21(28)30-15-11-26(12-15)18-19(23-10-9-22-18)29-14-7-5-13(6-8-14)24-20-25-16-3-1-2-4-17(16)31-20/h1-10,15H,11-12H2,(H,24,25)(H,27,28) |
| InChIKey | RURVNIWGOMASPR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate?
The IUPAC name of [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate (CID 89075218) is [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate.
What is the SMILES notation for [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate?
The canonical SMILES for [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate is O=C(O)OC1CN(c2nccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)C1.
What is the InChIKey of [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate?
The InChIKey is RURVNIWGOMASPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N5O4S/c27-21(28)30-15-11-26(12-15)18-19(23-10-9-22-18)29-14-7-5-13(6-8-14)24-20-25-16-3-1-2-4-17(16)31-20/h1-10,15H,11-12H2,(H,24,25)(H,27,28).
What are the key properties of [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate?
[1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate has a molecular weight of 435.47 g/mol, XLogP of 4.51, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]azetidin-3-yl] hydrogen carbonate is sourced from PubChem (CID 89075218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).